C14H15N3O2S — CID 63048716
N-(3-amino-3-oxopropyl)-N-benzyl-1,3-thiazole-4-carboxamide (PubChem CID 63048716) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-N-benzyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-amino-3-oxopropyl)-N-benzyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 63048716 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-N-benzyl-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)CCN(Cc1ccccc1)C(=O)c1cscn1 |
| InChI | InChI=1S/C14H15N3O2S/c15-13(18)6-7-17(8-11-4-2-1-3-5-11)14(19)12-9-20-10-16-12/h1-5,9-10H,6-8H2,(H2,15,18) |
| InChIKey | SDZNDYSMUGAICM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |