3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid

C14H14N2O3S — CID 138044082

IUPAC3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid
SMILESO=C(O)CCN(Cc1ccccc1)C(=O)c1cscn1
InChIInChI=1S/C14H14N2O3S/c17-13(18)6-7-16(8-11-4-2-1-3-5-11)14(19)12-9-20-10-15-12/h1-5,9-10H,6-8H2,(H,17,18)
InChIKeyYKYOVHPVVFEORE-UHFFFAOYSA-N
MW290.34 g/mol
LogP2.26
Rot. Bonds6

About 3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid

3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid (PubChem CID 138044082) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is 3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid.

Molecular Properties

Compound Name3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid
PubChem CID138044082
Molecular FormulaC14H14N2O3S
Molecular Weight290.34 g/mol
Exact Mass290.07
IUPAC Name3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid
SMILESO=C(O)CCN(Cc1ccccc1)C(=O)c1cscn1
InChIInChI=1S/C14H14N2O3S/c17-13(18)6-7-16(8-11-4-2-1-3-5-11)14(19)12-9-20-10-15-12/h1-5,9-10H,6-8H2,(H,17,18)
InChIKeyYKYOVHPVVFEORE-UHFFFAOYSA-N
XLogP2.26
TPSA70.50 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.34
LogP ≤ 52.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid?
The IUPAC name of 3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid (CID 138044082) is 3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid.
What is the SMILES notation for 3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid?
The canonical SMILES for 3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid is O=C(O)CCN(Cc1ccccc1)C(=O)c1cscn1.
What is the InChIKey of 3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid?
The InChIKey is YKYOVHPVVFEORE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3S/c17-13(18)6-7-16(8-11-4-2-1-3-5-11)14(19)12-9-20-10-15-12/h1-5,9-10H,6-8H2,(H,17,18).
What are the key properties of 3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid?
3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid has a molecular weight of 290.34 g/mol, XLogP of 2.26, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[benzyl(1,3-thiazole-4-carbonyl)amino]propanoic acid is sourced from PubChem (CID 138044082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).