C17H14N2OS — CID 62044821
N-benzyl-N-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 62044821) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is N-benzyl-N-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-benzyl-N-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62044821 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-benzyl-N-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(c1cscn1)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H14N2OS/c20-17(16-12-21-13-18-16)19(15-9-5-2-6-10-15)11-14-7-3-1-4-8-14/h1-10,12-13H,11H2 |
| InChIKey | ATSIQFJYASULMA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |