C16H13N3O2S — CID 86889157
1-oxido-N-[phenyl(1,3-thiazol-2-yl)methyl]pyridin-1-ium-4-carboxamide (PubChem CID 86889157) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 1-oxido-N-[phenyl(1,3-thiazol-2-yl)methyl]pyridin-1-ium-4-carboxamide.
| Compound Name | 1-oxido-N-[phenyl(1,3-thiazol-2-yl)methyl]pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 86889157 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 1-oxido-N-[phenyl(1,3-thiazol-2-yl)methyl]pyridin-1-ium-4-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1nccs1)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C16H13N3O2S/c20-15(13-6-9-19(21)10-7-13)18-14(16-17-8-11-22-16)12-4-2-1-3-5-12/h1-11,14H,(H,18,20) |
| InChIKey | LOZASNPFLAMDGO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|