C20H19ClFN3O3 — CID 86891599
(E)-1-[4-[2-(4-chlorophenoxy)acetyl]piperazin-1-yl]-3-(5-fluoro-3-pyridinyl)prop-2-en-1-one (PubChem CID 86891599) has the molecular formula C20H19ClFN3O3 and a molecular weight of 403.84 g/mol. Its IUPAC name is (E)-1-[4-[2-(4-chlorophenoxy)acetyl]piperazin-1-yl]-3-(5-fluoro-3-pyridinyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-(4-chlorophenoxy)acetyl]piperazin-1-yl]-3-(5-fluoro-3-pyridinyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 86891599 |
| Molecular Formula | C20H19ClFN3O3 |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | (E)-1-[4-[2-(4-chlorophenoxy)acetyl]piperazin-1-yl]-3-(5-fluoro-3-pyridinyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cncc(F)c1)N1CCN(C(=O)COc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H19ClFN3O3/c21-16-2-4-18(5-3-16)28-14-20(27)25-9-7-24(8-10-25)19(26)6-1-15-11-17(22)13-23-12-15/h1-6,11-13H,7-10,14H2/b6-1+ |
| InChIKey | DNQBFJPPOMKNLN-LZCJLJQNSA-N |
| XLogP | 2.64 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|