C19H27N3O4S — CID 8689395
N-[[(2R)-oxolan-2-yl]methyl]-2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]acetamide (PubChem CID 8689395) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8689395 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C19H27N3O4S/c23-19(20-15-18-7-4-13-26-18)16-21-9-11-22(12-10-21)27(24,25)14-8-17-5-2-1-3-6-17/h1-3,5-6,8,14,18H,4,7,9-13,15-16H2,(H,20,23)/b14-8+/t18-/m1/s1 |
| InChIKey | IVMDDHHLFSVGSU-ODHXBGJQSA-N |
| XLogP | 0.90 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |