C24H29FN4O2 — CID 86894062
N-[3-[[2-[(2-fluorophenyl)methyl]pyrazol-3-yl]amino]-3-oxopropyl]adamantane-1-carboxamide (PubChem CID 86894062) has the molecular formula C24H29FN4O2 and a molecular weight of 424.52 g/mol. Its IUPAC name is N-[3-[[2-[(2-fluorophenyl)methyl]pyrazol-3-yl]amino]-3-oxopropyl]adamantane-1-carboxamide.
| Compound Name | N-[3-[[2-[(2-fluorophenyl)methyl]pyrazol-3-yl]amino]-3-oxopropyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 86894062 |
| Molecular Formula | C24H29FN4O2 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | N-[3-[[2-[(2-fluorophenyl)methyl]pyrazol-3-yl]amino]-3-oxopropyl]adamantane-1-carboxamide |
| SMILES | O=C(CCNC(=O)C12CC3CC(CC(C3)C1)C2)Nc1ccnn1Cc1ccccc1F |
| InChI | InChI=1S/C24H29FN4O2/c25-20-4-2-1-3-19(20)15-29-21(5-8-27-29)28-22(30)6-7-26-23(31)24-12-16-9-17(13-24)11-18(10-16)14-24/h1-5,8,16-18H,6-7,9-15H2,(H,26,31)(H,28,30) |
| InChIKey | JZROIBGYRCKFSW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |