C21H30N4O2 — CID 86894797
N-methyl-2-(4-propoxyphenoxy)-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]ethanamine (PubChem CID 86894797) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-methyl-2-(4-propoxyphenoxy)-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]ethanamine.
| Compound Name | N-methyl-2-(4-propoxyphenoxy)-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 86894797 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-methyl-2-(4-propoxyphenoxy)-N-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]ethanamine |
| SMILES | CCCOc1ccc(OCCN(C)CC2CCCN2c2cccnn2)cc1 |
| InChI | InChI=1S/C21H30N4O2/c1-3-15-26-19-8-10-20(11-9-19)27-16-14-24(2)17-18-6-5-13-25(18)21-7-4-12-22-23-21/h4,7-12,18H,3,5-6,13-17H2,1-2H3 |
| InChIKey | AMJFHYDDJGOHBT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |