C22H36N4O2 — CID 86895019
1-(4-benzylpiperazin-1-yl)-2-[4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]ethanone (PubChem CID 86895019) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2-[4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]ethanone.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2-[4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 86895019 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2-[4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]ethanone |
| SMILES | CCOCCN1CCN(CC(=O)N2CCN(Cc3ccccc3)CC2)CC1C |
| InChI | InChI=1S/C22H36N4O2/c1-3-28-16-15-25-12-11-24(17-20(25)2)19-22(27)26-13-9-23(10-14-26)18-21-7-5-4-6-8-21/h4-8,20H,3,9-19H2,1-2H3 |
| InChIKey | PKQOBMXAOZYXKI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|