C17H23BrN4O3 — CID 86895803
[5-[(4-bromopyrazol-1-yl)methyl]furan-2-yl]-[4-(2-hydroxybutyl)piperazin-1-yl]methanone (PubChem CID 86895803) has the molecular formula C17H23BrN4O3 and a molecular weight of 411.30 g/mol. Its IUPAC name is [5-[(4-bromopyrazol-1-yl)methyl]furan-2-yl]-[4-(2-hydroxybutyl)piperazin-1-yl]methanone.
| Compound Name | [5-[(4-bromopyrazol-1-yl)methyl]furan-2-yl]-[4-(2-hydroxybutyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 86895803 |
| Molecular Formula | C17H23BrN4O3 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | [5-[(4-bromopyrazol-1-yl)methyl]furan-2-yl]-[4-(2-hydroxybutyl)piperazin-1-yl]methanone |
| SMILES | CCC(O)CN1CCN(C(=O)c2ccc(Cn3cc(Br)cn3)o2)CC1 |
| InChI | InChI=1S/C17H23BrN4O3/c1-2-14(23)11-20-5-7-21(8-6-20)17(24)16-4-3-15(25-16)12-22-10-13(18)9-19-22/h3-4,9-10,14,23H,2,5-8,11-12H2,1H3 |
| InChIKey | CAKVDDOWAYCXNM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |