C17H12ClN5O — CID 86895935
1-[1-(2-chlorophenyl)pyrazol-4-yl]-3-(4-cyanophenyl)urea (PubChem CID 86895935) has the molecular formula C17H12ClN5O and a molecular weight of 337.77 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)pyrazol-4-yl]-3-(4-cyanophenyl)urea.
| Compound Name | 1-[1-(2-chlorophenyl)pyrazol-4-yl]-3-(4-cyanophenyl)urea |
|---|---|
| PubChem CID | 86895935 |
| Molecular Formula | C17H12ClN5O |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-[1-(2-chlorophenyl)pyrazol-4-yl]-3-(4-cyanophenyl)urea |
| SMILES | N#Cc1ccc(NC(=O)Nc2cnn(-c3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C17H12ClN5O/c18-15-3-1-2-4-16(15)23-11-14(10-20-23)22-17(24)21-13-7-5-12(9-19)6-8-13/h1-8,10-11H,(H2,21,22,24) |
| InChIKey | ABASTDYGDZCING-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |