About 2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate
2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 86897194) has the molecular formula C18H20O4S
and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate.
Molecular Properties
| Compound Name | 2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate |
| PubChem CID | 86897194 |
| Molecular Formula | C18H20O4S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | CCOc1ccc2c(c1)CC(C(=O)OCCc1cccs1)CO2 |
| InChI | InChI=1S/C18H20O4S/c1-2-20-15-5-6-17-13(11-15)10-14(12-22-17)18(19)21-8-7-16-4-3-9-23-16/h3-6,9,11,14H,2,7-8,10,12H2,1H3 |
| InChIKey | RFLZPNFCJOQGJT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate?
The IUPAC name of 2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate (CID 86897194) is 2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate.
What is the SMILES notation for 2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate?
The canonical SMILES for 2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate is CCOc1ccc2c(c1)CC(C(=O)OCCc1cccs1)CO2.
What is the InChIKey of 2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate?
The InChIKey is RFLZPNFCJOQGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O4S/c1-2-20-15-5-6-17-13(11-15)10-14(12-22-17)18(19)21-8-7-16-4-3-9-23-16/h3-6,9,11,14H,2,7-8,10,12H2,1H3.
What are the key properties of 2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate?
2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate has a molecular weight of 332.42 g/mol, XLogP of 3.48, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylethyl 6-ethoxy-3,4-dihydro-2H-chromene-3-carboxylate is sourced from PubChem (CID 86897194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).