C25H32FN3O3 — CID 86898399
N-[4-[3-(dimethylamino)propoxy]phenyl]-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxamide (PubChem CID 86898399) has the molecular formula C25H32FN3O3 and a molecular weight of 441.55 g/mol. Its IUPAC name is N-[4-[3-(dimethylamino)propoxy]phenyl]-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxamide.
| Compound Name | N-[4-[3-(dimethylamino)propoxy]phenyl]-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 86898399 |
| Molecular Formula | C25H32FN3O3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-[4-[3-(dimethylamino)propoxy]phenyl]-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxamide |
| SMILES | CN(C)CCCOc1ccc(NC(=O)C2CCCN(C(=O)Cc3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C25H32FN3O3/c1-28(2)14-4-16-32-23-12-10-22(11-13-23)27-25(31)20-5-3-15-29(18-20)24(30)17-19-6-8-21(26)9-7-19/h6-13,20H,3-5,14-18H2,1-2H3,(H,27,31) |
| InChIKey | AORVCTVJPIRTCB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|