C25H24N4O3 — CID 86898588
N-benzyl-4-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-(1-pyridin-2-ylethyl)benzamide (PubChem CID 86898588) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-benzyl-4-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-(1-pyridin-2-ylethyl)benzamide.
| Compound Name | N-benzyl-4-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-(1-pyridin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 86898588 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-benzyl-4-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-(1-pyridin-2-ylethyl)benzamide |
| SMILES | CC(c1ccccn1)N(Cc1ccccc1)C(=O)c1ccc(CN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C25H24N4O3/c1-18(22-9-5-6-14-26-22)28(16-19-7-3-2-4-8-19)24(31)21-12-10-20(11-13-21)17-29-23(30)15-27-25(29)32/h2-14,18H,15-17H2,1H3,(H,27,32) |
| InChIKey | PORRPDRSDODPPU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|