C23H25N3O3S — CID 86898727
N-[2-[[4-[3-(dimethylamino)propoxy]phenyl]carbamoyl]phenyl]thiophene-3-carboxamide (PubChem CID 86898727) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-[2-[[4-[3-(dimethylamino)propoxy]phenyl]carbamoyl]phenyl]thiophene-3-carboxamide.
| Compound Name | N-[2-[[4-[3-(dimethylamino)propoxy]phenyl]carbamoyl]phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 86898727 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-[2-[[4-[3-(dimethylamino)propoxy]phenyl]carbamoyl]phenyl]thiophene-3-carboxamide |
| SMILES | CN(C)CCCOc1ccc(NC(=O)c2ccccc2NC(=O)c2ccsc2)cc1 |
| InChI | InChI=1S/C23H25N3O3S/c1-26(2)13-5-14-29-19-10-8-18(9-11-19)24-23(28)20-6-3-4-7-21(20)25-22(27)17-12-15-30-16-17/h3-4,6-12,15-16H,5,13-14H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | XUIPXLGVRXXBHB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|