C22H27N3O — CID 86899684
1-[(4-ethylphenyl)methyl]-3-[3-(1H-indol-3-yl)propyl]-1-methylurea (PubChem CID 86899684) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-[(4-ethylphenyl)methyl]-3-[3-(1H-indol-3-yl)propyl]-1-methylurea.
| Compound Name | 1-[(4-ethylphenyl)methyl]-3-[3-(1H-indol-3-yl)propyl]-1-methylurea |
|---|---|
| PubChem CID | 86899684 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1-[(4-ethylphenyl)methyl]-3-[3-(1H-indol-3-yl)propyl]-1-methylurea |
| SMILES | CCc1ccc(CN(C)C(=O)NCCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C22H27N3O/c1-3-17-10-12-18(13-11-17)16-25(2)22(26)23-14-6-7-19-15-24-21-9-5-4-8-20(19)21/h4-5,8-13,15,24H,3,6-7,14,16H2,1-2H3,(H,23,26) |
| InChIKey | GVBZUJHOESMALK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|