C16H22INO3 — CID 86900175
N-[2-(cyclopropylmethoxy)ethyl]-4-(4-iodophenoxy)butanamide (PubChem CID 86900175) has the molecular formula C16H22INO3 and a molecular weight of 403.26 g/mol. Its IUPAC name is N-[2-(cyclopropylmethoxy)ethyl]-4-(4-iodophenoxy)butanamide.
| Compound Name | N-[2-(cyclopropylmethoxy)ethyl]-4-(4-iodophenoxy)butanamide |
|---|---|
| PubChem CID | 86900175 |
| Molecular Formula | C16H22INO3 |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | N-[2-(cyclopropylmethoxy)ethyl]-4-(4-iodophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccc(I)cc1)NCCOCC1CC1 |
| InChI | InChI=1S/C16H22INO3/c17-14-5-7-15(8-6-14)21-10-1-2-16(19)18-9-11-20-12-13-3-4-13/h5-8,13H,1-4,9-12H2,(H,18,19) |
| InChIKey | VPEFDUTZIXVJKL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|