C22H29N3O2S — CID 86900693
1-[2-(cyclopropylmethoxy)ethyl]-3-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]urea (PubChem CID 86900693) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethoxy)ethyl]-3-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]urea.
| Compound Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]urea |
|---|---|
| PubChem CID | 86900693 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-phenylethyl]urea |
| SMILES | O=C(NCCOCC1CC1)NCC(c1ccccc1)N1CCc2sccc2C1 |
| InChI | InChI=1S/C22H29N3O2S/c26-22(23-10-12-27-16-17-6-7-17)24-14-20(18-4-2-1-3-5-18)25-11-8-21-19(15-25)9-13-28-21/h1-5,9,13,17,20H,6-8,10-12,14-16H2,(H2,23,24,26) |
| InChIKey | CAKGASBOCJGATP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|