C22H28BrN3O2 — CID 86902149
1-[3-(3-bromophenyl)propyl]-3-[[4-(morpholin-4-ylmethyl)phenyl]methyl]urea (PubChem CID 86902149) has the molecular formula C22H28BrN3O2 and a molecular weight of 446.39 g/mol. Its IUPAC name is 1-[3-(3-bromophenyl)propyl]-3-[[4-(morpholin-4-ylmethyl)phenyl]methyl]urea.
| Compound Name | 1-[3-(3-bromophenyl)propyl]-3-[[4-(morpholin-4-ylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 86902149 |
| Molecular Formula | C22H28BrN3O2 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 1-[3-(3-bromophenyl)propyl]-3-[[4-(morpholin-4-ylmethyl)phenyl]methyl]urea |
| SMILES | O=C(NCCCc1cccc(Br)c1)NCc1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C22H28BrN3O2/c23-21-5-1-3-18(15-21)4-2-10-24-22(27)25-16-19-6-8-20(9-7-19)17-26-11-13-28-14-12-26/h1,3,5-9,15H,2,4,10-14,16-17H2,(H2,24,25,27) |
| InChIKey | FWYDPZHMSCYCPH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|