C21H26N4O2 — CID 86904635
1-[3-(2,6-dimethylphenoxy)propyl]-3-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]urea (PubChem CID 86904635) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylphenoxy)propyl]-3-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]urea.
| Compound Name | 1-[3-(2,6-dimethylphenoxy)propyl]-3-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 86904635 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-[3-(2,6-dimethylphenoxy)propyl]-3-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]urea |
| SMILES | Cc1cccc(C)c1OCCCNC(=O)NCc1cn2c(C)cccc2n1 |
| InChI | InChI=1S/C21H26N4O2/c1-15-7-4-8-16(2)20(15)27-12-6-11-22-21(26)23-13-18-14-25-17(3)9-5-10-19(25)24-18/h4-5,7-10,14H,6,11-13H2,1-3H3,(H2,22,23,26) |
| InChIKey | YEGOJUFQXPUCFR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|