About 1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate
1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate (PubChem CID 86904893) has the molecular formula C16H18ClFN2O3
and a molecular weight of 340.78 g/mol. Its IUPAC name is 1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate.
Molecular Properties
| Compound Name | 1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate |
| PubChem CID | 86904893 |
| Molecular Formula | C16H18ClFN2O3 |
| Molecular Weight | 340.78 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate |
| SMILES | Cc1nn(CC(=O)OC(C)COc2cccc(F)c2)c(C)c1Cl |
| InChI | InChI=1S/C16H18ClFN2O3/c1-10(9-22-14-6-4-5-13(18)7-14)23-15(21)8-20-12(3)16(17)11(2)19-20/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | ALBSBQSPRVBSAM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate?
The IUPAC name of 1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate (CID 86904893) is 1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate.
What is the SMILES notation for 1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate?
The canonical SMILES for 1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate is Cc1nn(CC(=O)OC(C)COc2cccc(F)c2)c(C)c1Cl.
What is the InChIKey of 1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate?
The InChIKey is ALBSBQSPRVBSAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClFN2O3/c1-10(9-22-14-6-4-5-13(18)7-14)23-15(21)8-20-12(3)16(17)11(2)19-20/h4-7,10H,8-9H2,1-3H3.
What are the key properties of 1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate?
1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate has a molecular weight of 340.78 g/mol, XLogP of 3.30, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluorophenoxy)propan-2-yl 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate is sourced from PubChem (CID 86904893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).