C16H17FO3S — CID 86904818
1-(3-fluorophenoxy)propan-2-yl 3-thiophen-2-ylpropanoate (PubChem CID 86904818) has the molecular formula C16H17FO3S and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-(3-fluorophenoxy)propan-2-yl 3-thiophen-2-ylpropanoate.
| Compound Name | 1-(3-fluorophenoxy)propan-2-yl 3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 86904818 |
| Molecular Formula | C16H17FO3S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-(3-fluorophenoxy)propan-2-yl 3-thiophen-2-ylpropanoate |
| SMILES | CC(COc1cccc(F)c1)OC(=O)CCc1cccs1 |
| InChI | InChI=1S/C16H17FO3S/c1-12(11-19-14-5-2-4-13(17)10-14)20-16(18)8-7-15-6-3-9-21-15/h2-6,9-10,12H,7-8,11H2,1H3 |
| InChIKey | FACZYSNNTLAVHM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |