C16H16FIN4O — CID 86905086
(5-fluoro-2-iodophenyl)-(4-pyridazin-3-yl-1,4-diazepan-1-yl)methanone (PubChem CID 86905086) has the molecular formula C16H16FIN4O and a molecular weight of 426.23 g/mol. Its IUPAC name is (5-fluoro-2-iodophenyl)-(4-pyridazin-3-yl-1,4-diazepan-1-yl)methanone.
| Compound Name | (5-fluoro-2-iodophenyl)-(4-pyridazin-3-yl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 86905086 |
| Molecular Formula | C16H16FIN4O |
| Molecular Weight | 426.23 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | (5-fluoro-2-iodophenyl)-(4-pyridazin-3-yl-1,4-diazepan-1-yl)methanone |
| SMILES | O=C(c1cc(F)ccc1I)N1CCCN(c2cccnn2)CC1 |
| InChI | InChI=1S/C16H16FIN4O/c17-12-4-5-14(18)13(11-12)16(23)22-8-2-7-21(9-10-22)15-3-1-6-19-20-15/h1,3-6,11H,2,7-10H2 |
| InChIKey | PIVBVKCXHOXULT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|