C20H26N4O3S — CID 86905409
N-[4-hydroxy-3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepane-1-carbonyl]phenyl]propanamide (PubChem CID 86905409) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[4-hydroxy-3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepane-1-carbonyl]phenyl]propanamide.
| Compound Name | N-[4-hydroxy-3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepane-1-carbonyl]phenyl]propanamide |
|---|---|
| PubChem CID | 86905409 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[4-hydroxy-3-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepane-1-carbonyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(O)c(C(=O)N2CCCN(Cc3csc(C)n3)CC2)c1 |
| InChI | InChI=1S/C20H26N4O3S/c1-3-19(26)22-15-5-6-18(25)17(11-15)20(27)24-8-4-7-23(9-10-24)12-16-13-28-14(2)21-16/h5-6,11,13,25H,3-4,7-10,12H2,1-2H3,(H,22,26) |
| InChIKey | VCALMCVBXPSSGY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|