C25H30N4O2 — CID 86906124
2-(4-methyl-N-[2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl]anilino)-1-piperidin-1-ylethanone (PubChem CID 86906124) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-(4-methyl-N-[2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl]anilino)-1-piperidin-1-ylethanone.
| Compound Name | 2-(4-methyl-N-[2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl]anilino)-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 86906124 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 2-(4-methyl-N-[2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl]anilino)-1-piperidin-1-ylethanone |
| SMILES | Cc1ccc(N(CC(=O)N2CCCCC2)CC(=O)N2CCC(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C25H30N4O2/c1-20-10-12-22(13-11-20)28(18-24(30)27-15-6-3-7-16-27)19-25(31)29-17-14-23(26-29)21-8-4-2-5-9-21/h2,4-5,8-13H,3,6-7,14-19H2,1H3 |
| InChIKey | VFBSJJFMFOTMPD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|