C27H36N4O2 — CID 86906158
2-(4-methyl-N-(2-oxo-2-piperidin-1-ylethyl)anilino)-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide (PubChem CID 86906158) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 2-(4-methyl-N-(2-oxo-2-piperidin-1-ylethyl)anilino)-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide.
| Compound Name | 2-(4-methyl-N-(2-oxo-2-piperidin-1-ylethyl)anilino)-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 86906158 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 2-(4-methyl-N-(2-oxo-2-piperidin-1-ylethyl)anilino)-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide |
| SMILES | Cc1ccc(N(CC(=O)NCC2CCN(c3ccccc3)C2)CC(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C27H36N4O2/c1-22-10-12-25(13-11-22)31(21-27(33)29-15-6-3-7-16-29)20-26(32)28-18-23-14-17-30(19-23)24-8-4-2-5-9-24/h2,4-5,8-13,23H,3,6-7,14-21H2,1H3,(H,28,32) |
| InChIKey | SUSVBURQIQGUGE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|