C19H14N4OS — CID 86907870
4-methyl-2-pyridin-2-yl-N-quinolin-5-yl-1,3-thiazole-5-carboxamide (PubChem CID 86907870) has the molecular formula C19H14N4OS and a molecular weight of 346.42 g/mol. Its IUPAC name is 4-methyl-2-pyridin-2-yl-N-quinolin-5-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-2-pyridin-2-yl-N-quinolin-5-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 86907870 |
| Molecular Formula | C19H14N4OS |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 4-methyl-2-pyridin-2-yl-N-quinolin-5-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccccn2)sc1C(=O)Nc1cccc2ncccc12 |
| InChI | InChI=1S/C19H14N4OS/c1-12-17(25-19(22-12)16-7-2-3-10-21-16)18(24)23-15-9-4-8-14-13(15)6-5-11-20-14/h2-11H,1H3,(H,23,24) |
| InChIKey | ACGKBZSKQSKLFI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |