C20H18ClN3O2 — CID 86911558
2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-N-prop-2-enylbenzamide (PubChem CID 86911558) has the molecular formula C20H18ClN3O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-N-prop-2-enylbenzamide.
| Compound Name | 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 86911558 |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NCc1ncc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C20H18ClN3O2/c1-2-10-22-20(25)16-8-3-4-9-17(16)23-13-19-24-12-18(26-19)14-6-5-7-15(21)11-14/h2-9,11-12,23H,1,10,13H2,(H,22,25) |
| InChIKey | XQLPTQPNNYSIQJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|