C16H21N5 — CID 86911616
5-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]pentanenitrile (PubChem CID 86911616) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 5-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]pentanenitrile.
| Compound Name | 5-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 86911616 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 5-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]pentanenitrile |
| SMILES | N#CCCCCN1CCC(c2nnc3ccccn23)CC1 |
| InChI | InChI=1S/C16H21N5/c17-9-3-1-4-10-20-12-7-14(8-13-20)16-19-18-15-6-2-5-11-21(15)16/h2,5-6,11,14H,1,3-4,7-8,10,12-13H2 |
| InChIKey | RTOGENODWLOXAG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 57.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|