C16H14N4O3 — CID 86913149
2-methyl-3-nitro-N-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]aniline (PubChem CID 86913149) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-methyl-3-nitro-N-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]aniline.
| Compound Name | 2-methyl-3-nitro-N-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 86913149 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-methyl-3-nitro-N-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]aniline |
| SMILES | Cc1c(NCc2noc(-c3ccccc3)n2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N4O3/c1-11-13(8-5-9-14(11)20(21)22)17-10-15-18-16(23-19-15)12-6-3-2-4-7-12/h2-9,17H,10H2,1H3 |
| InChIKey | NKSPKJGTEGAOBK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|