C18H28ClN3O2 — CID 86919184
2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-N-[1-(4-chlorophenyl)propyl]acetamide (PubChem CID 86919184) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is 2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-N-[1-(4-chlorophenyl)propyl]acetamide.
| Compound Name | 2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-N-[1-(4-chlorophenyl)propyl]acetamide |
|---|---|
| PubChem CID | 86919184 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-N-[1-(4-chlorophenyl)propyl]acetamide |
| SMILES | CCC(NC(=O)CN(C)CC(=O)NC(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H28ClN3O2/c1-6-15(13-7-9-14(19)10-8-13)20-16(23)11-22(5)12-17(24)21-18(2,3)4/h7-10,15H,6,11-12H2,1-5H3,(H,20,23)(H,21,24) |
| InChIKey | VPCCMZZPNYAIAL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |