C16H22ClNO3 — CID 62933020
5-[1-(4-chlorophenyl)propylamino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 62933020) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is 5-[1-(4-chlorophenyl)propylamino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[1-(4-chlorophenyl)propylamino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62933020 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 5-[1-(4-chlorophenyl)propylamino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CCC(NC(=O)CC(C)(C)CC(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClNO3/c1-4-13(11-5-7-12(17)8-6-11)18-14(19)9-16(2,3)10-15(20)21/h5-8,13H,4,9-10H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | RUYAYQOGXIFFNV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |