C20H17N3O3S — CID 86920255
N-[5-[(4-cyanophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethoxybenzamide (PubChem CID 86920255) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[5-[(4-cyanophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethoxybenzamide.
| Compound Name | N-[5-[(4-cyanophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 86920255 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[5-[(4-cyanophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)Nc2ncc(Cc3ccc(C#N)cc3)s2)c1 |
| InChI | InChI=1S/C20H17N3O3S/c1-25-15-7-8-18(26-2)17(10-15)19(24)23-20-22-12-16(27-20)9-13-3-5-14(11-21)6-4-13/h3-8,10,12H,9H2,1-2H3,(H,22,23,24) |
| InChIKey | VZXADHPTKPMCFL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |