C18H23N7O3 — CID 86921331
N-[3-(furan-2-ylmethoxy)propyl]-1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidine-4-carboxamide (PubChem CID 86921331) has the molecular formula C18H23N7O3 and a molecular weight of 385.43 g/mol. Its IUPAC name is N-[3-(furan-2-ylmethoxy)propyl]-1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidine-4-carboxamide.
| Compound Name | N-[3-(furan-2-ylmethoxy)propyl]-1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86921331 |
| Molecular Formula | C18H23N7O3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[3-(furan-2-ylmethoxy)propyl]-1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCOCc1ccco1)C1CCN(c2ccc3nnnn3n2)CC1 |
| InChI | InChI=1S/C18H23N7O3/c26-18(19-8-2-11-27-13-15-3-1-12-28-15)14-6-9-24(10-7-14)17-5-4-16-20-22-23-25(16)21-17/h1,3-5,12,14H,2,6-11,13H2,(H,19,26) |
| InChIKey | AMCPSODLWCYOPV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|