C18H20N4O3 — CID 86923192
N-[2-[[4-(carbamoylamino)phenyl]methylamino]-2-oxoethyl]-N-methylbenzamide (PubChem CID 86923192) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[2-[[4-(carbamoylamino)phenyl]methylamino]-2-oxoethyl]-N-methylbenzamide.
| Compound Name | N-[2-[[4-(carbamoylamino)phenyl]methylamino]-2-oxoethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 86923192 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[2-[[4-(carbamoylamino)phenyl]methylamino]-2-oxoethyl]-N-methylbenzamide |
| SMILES | CN(CC(=O)NCc1ccc(NC(N)=O)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20N4O3/c1-22(17(24)14-5-3-2-4-6-14)12-16(23)20-11-13-7-9-15(10-8-13)21-18(19)25/h2-10H,11-12H2,1H3,(H,20,23)(H3,19,21,25) |
| InChIKey | JVAFSVGLSZFLKG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |