C16H23FN2O4S — CID 86923726
2-(4-fluorophenoxy)-2-methyl-N-(1-methylsulfonylpiperidin-4-yl)propanamide (PubChem CID 86923726) has the molecular formula C16H23FN2O4S and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-2-methyl-N-(1-methylsulfonylpiperidin-4-yl)propanamide.
| Compound Name | 2-(4-fluorophenoxy)-2-methyl-N-(1-methylsulfonylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 86923726 |
| Molecular Formula | C16H23FN2O4S |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-(4-fluorophenoxy)-2-methyl-N-(1-methylsulfonylpiperidin-4-yl)propanamide |
| SMILES | CC(C)(Oc1ccc(F)cc1)C(=O)NC1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H23FN2O4S/c1-16(2,23-14-6-4-12(17)5-7-14)15(20)18-13-8-10-19(11-9-13)24(3,21)22/h4-7,13H,8-11H2,1-3H3,(H,18,20) |
| InChIKey | ODDLJTCLALUXJG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |