C17H21FN4O3S — CID 86924757
N-[1-[1-(4-fluorophenyl)-5-methylpyrazole-4-carbonyl]piperidin-4-yl]methanesulfonamide (PubChem CID 86924757) has the molecular formula C17H21FN4O3S and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[1-[1-(4-fluorophenyl)-5-methylpyrazole-4-carbonyl]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-[1-(4-fluorophenyl)-5-methylpyrazole-4-carbonyl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 86924757 |
| Molecular Formula | C17H21FN4O3S |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-[1-[1-(4-fluorophenyl)-5-methylpyrazole-4-carbonyl]piperidin-4-yl]methanesulfonamide |
| SMILES | Cc1c(C(=O)N2CCC(NS(C)(=O)=O)CC2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H21FN4O3S/c1-12-16(11-19-22(12)15-5-3-13(18)4-6-15)17(23)21-9-7-14(8-10-21)20-26(2,24)25/h3-6,11,14,20H,7-10H2,1-2H3 |
| InChIKey | LPZYOVBCQPPKTO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |