C20H23FN4O2S — CID 166916424
N-[1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]piperidin-4-yl]methanesulfonamide (PubChem CID 166916424) has the molecular formula C20H23FN4O2S and a molecular weight of 402.50 g/mol. Its IUPAC name is N-[1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 166916424 |
| Molecular Formula | C20H23FN4O2S |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]piperidin-4-yl]methanesulfonamide |
| SMILES | Cc1cc2c(cnn2-c2ccc(F)cc2)cc1N1CCC(NS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C20H23FN4O2S/c1-14-11-20-15(13-22-25(20)18-5-3-16(21)4-6-18)12-19(14)24-9-7-17(8-10-24)23-28(2,26)27/h3-6,11-13,17,23H,7-10H2,1-2H3 |
| InChIKey | DRCVQGOMXVBHIK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |