C23H24FN5S — CID 166917364
1-(4-fluorophenyl)-6-methyl-5-[4-(1-methylpyrazol-4-yl)sulfanylpiperidin-1-yl]indazole (PubChem CID 166917364) has the molecular formula C23H24FN5S and a molecular weight of 421.55 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-6-methyl-5-[4-(1-methylpyrazol-4-yl)sulfanylpiperidin-1-yl]indazole.
| Compound Name | 1-(4-fluorophenyl)-6-methyl-5-[4-(1-methylpyrazol-4-yl)sulfanylpiperidin-1-yl]indazole |
|---|---|
| PubChem CID | 166917364 |
| Molecular Formula | C23H24FN5S |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 1-(4-fluorophenyl)-6-methyl-5-[4-(1-methylpyrazol-4-yl)sulfanylpiperidin-1-yl]indazole |
| SMILES | Cc1cc2c(cnn2-c2ccc(F)cc2)cc1N1CCC(Sc2cnn(C)c2)CC1 |
| InChI | InChI=1S/C23H24FN5S/c1-16-11-23-17(13-26-29(23)19-5-3-18(24)4-6-19)12-22(16)28-9-7-20(8-10-28)30-21-14-25-27(2)15-21/h3-6,11-15,20H,7-10H2,1-2H3 |
| InChIKey | DBUPNOAHKAKNCO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |