C19H16FN3 — CID 175885811
5-(2,3-dihydropyridin-4-yl)-1-(4-fluorophenyl)-6-methylindazole (PubChem CID 175885811) has the molecular formula C19H16FN3 and a molecular weight of 305.36 g/mol. Its IUPAC name is 5-(2,3-dihydropyridin-4-yl)-1-(4-fluorophenyl)-6-methylindazole.
| Compound Name | 5-(2,3-dihydropyridin-4-yl)-1-(4-fluorophenyl)-6-methylindazole |
|---|---|
| PubChem CID | 175885811 |
| Molecular Formula | C19H16FN3 |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 5-(2,3-dihydropyridin-4-yl)-1-(4-fluorophenyl)-6-methylindazole |
| SMILES | Cc1cc2c(cnn2-c2ccc(F)cc2)cc1C1=CC=NCC1 |
| InChI | InChI=1S/C19H16FN3/c1-13-10-19-15(11-18(13)14-6-8-21-9-7-14)12-22-23(19)17-4-2-16(20)3-5-17/h2-6,8,10-12H,7,9H2,1H3 |
| InChIKey | NIBGTAKNBLEAGW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |