C18H15FN2O — CID 86722325
1-(4-fluorophenyl)-5,7,8,9-tetrahydrocyclohepta[f]indazol-6-one (PubChem CID 86722325) has the molecular formula C18H15FN2O and a molecular weight of 294.33 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5,7,8,9-tetrahydrocyclohepta[f]indazol-6-one.
| Compound Name | 1-(4-fluorophenyl)-5,7,8,9-tetrahydrocyclohepta[f]indazol-6-one |
|---|---|
| PubChem CID | 86722325 |
| Molecular Formula | C18H15FN2O |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-(4-fluorophenyl)-5,7,8,9-tetrahydrocyclohepta[f]indazol-6-one |
| SMILES | O=C1CCCc2cc3c(cnn3-c3ccc(F)cc3)cc2C1 |
| InChI | InChI=1S/C18H15FN2O/c19-15-4-6-16(7-5-15)21-18-10-12-2-1-3-17(22)9-13(12)8-14(18)11-20-21/h4-8,10-11H,1-3,9H2 |
| InChIKey | LXMWQXZBZKYDEK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |