C19H21FN4O2S — CID 163977915
1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-N-methylpyrrolidine-3-sulfonamide (PubChem CID 163977915) has the molecular formula C19H21FN4O2S and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-N-methylpyrrolidine-3-sulfonamide.
| Compound Name | 1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-N-methylpyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 163977915 |
| Molecular Formula | C19H21FN4O2S |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-[1-(4-fluorophenyl)-6-methylindazol-5-yl]-N-methylpyrrolidine-3-sulfonamide |
| SMILES | CNS(=O)(=O)C1CCN(c2cc3cnn(-c4ccc(F)cc4)c3cc2C)C1 |
| InChI | InChI=1S/C19H21FN4O2S/c1-13-9-19-14(11-22-24(19)16-5-3-15(20)4-6-16)10-18(13)23-8-7-17(12-23)27(25,26)21-2/h3-6,9-11,17,21H,7-8,12H2,1-2H3 |
| InChIKey | SVUHIBQUXPEZNE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |