C20H25FN4 — CID 168961672
ethane;1-(4-fluorophenyl)-6-methyl-5-piperazin-2-ylindazole (PubChem CID 168961672) has the molecular formula C20H25FN4 and a molecular weight of 340.45 g/mol. Its IUPAC name is ethane;1-(4-fluorophenyl)-6-methyl-5-piperazin-2-ylindazole.
| Compound Name | ethane;1-(4-fluorophenyl)-6-methyl-5-piperazin-2-ylindazole |
|---|---|
| PubChem CID | 168961672 |
| Molecular Formula | C20H25FN4 |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | ethane;1-(4-fluorophenyl)-6-methyl-5-piperazin-2-ylindazole |
| SMILES | CC.Cc1cc2c(cnn2-c2ccc(F)cc2)cc1C1CNCCN1 |
| InChI | InChI=1S/C18H19FN4.C2H6/c1-12-8-18-13(9-16(12)17-11-20-6-7-21-17)10-22-23(18)15-4-2-14(19)3-5-15;1-2/h2-5,8-10,17,20-21H,6-7,11H2,1H3;1-2H3 |
| InChIKey | JXLDMPMVDKMENF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |