C23H26FN7S — CID 168961481
5-[1-ethyl-4-(2-methyltriazol-4-yl)sulfanylpiperazin-2-yl]-1-(4-fluorophenyl)-6-methylindazole (PubChem CID 168961481) has the molecular formula C23H26FN7S and a molecular weight of 451.58 g/mol. Its IUPAC name is 5-[1-ethyl-4-(2-methyltriazol-4-yl)sulfanylpiperazin-2-yl]-1-(4-fluorophenyl)-6-methylindazole.
| Compound Name | 5-[1-ethyl-4-(2-methyltriazol-4-yl)sulfanylpiperazin-2-yl]-1-(4-fluorophenyl)-6-methylindazole |
|---|---|
| PubChem CID | 168961481 |
| Molecular Formula | C23H26FN7S |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 5-[1-ethyl-4-(2-methyltriazol-4-yl)sulfanylpiperazin-2-yl]-1-(4-fluorophenyl)-6-methylindazole |
| SMILES | CCN1CCN(Sc2cnn(C)n2)CC1c1cc2cnn(-c3ccc(F)cc3)c2cc1C |
| InChI | InChI=1S/C23H26FN7S/c1-4-29-9-10-30(32-23-14-25-28(3)27-23)15-22(29)20-12-17-13-26-31(21(17)11-16(20)2)19-7-5-18(24)6-8-19/h5-8,11-14,22H,4,9-10,15H2,1-3H3 |
| InChIKey | LVRLJKOJSQPRMQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|