C25H28FN7OS — CID 168961443
1-(4-fluorophenyl)-6-methyl-5-[4-(2-methyltriazol-4-yl)sulfanyl-1-(oxetan-3-ylmethyl)piperazin-2-yl]indazole (PubChem CID 168961443) has the molecular formula C25H28FN7OS and a molecular weight of 493.61 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-6-methyl-5-[4-(2-methyltriazol-4-yl)sulfanyl-1-(oxetan-3-ylmethyl)piperazin-2-yl]indazole.
| Compound Name | 1-(4-fluorophenyl)-6-methyl-5-[4-(2-methyltriazol-4-yl)sulfanyl-1-(oxetan-3-ylmethyl)piperazin-2-yl]indazole |
|---|---|
| PubChem CID | 168961443 |
| Molecular Formula | C25H28FN7OS |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 1-(4-fluorophenyl)-6-methyl-5-[4-(2-methyltriazol-4-yl)sulfanyl-1-(oxetan-3-ylmethyl)piperazin-2-yl]indazole |
| SMILES | Cc1cc2c(cnn2-c2ccc(F)cc2)cc1C1CN(Sc2cnn(C)n2)CCN1CC1COC1 |
| InChI | InChI=1S/C25H28FN7OS/c1-17-9-23-19(11-28-33(23)21-5-3-20(26)4-6-21)10-22(17)24-14-32(35-25-12-27-30(2)29-25)8-7-31(24)13-18-15-34-16-18/h3-6,9-12,18,24H,7-8,13-16H2,1-2H3 |
| InChIKey | CREFYPOMYMSGOH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|