C26H27FN4S — CID 168961526
5-(1-benzyl-4-methylsulfanylpiperazin-2-yl)-1-(4-fluorophenyl)-6-methylindazole (PubChem CID 168961526) has the molecular formula C26H27FN4S and a molecular weight of 446.60 g/mol. Its IUPAC name is 5-(1-benzyl-4-methylsulfanylpiperazin-2-yl)-1-(4-fluorophenyl)-6-methylindazole.
| Compound Name | 5-(1-benzyl-4-methylsulfanylpiperazin-2-yl)-1-(4-fluorophenyl)-6-methylindazole |
|---|---|
| PubChem CID | 168961526 |
| Molecular Formula | C26H27FN4S |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 5-(1-benzyl-4-methylsulfanylpiperazin-2-yl)-1-(4-fluorophenyl)-6-methylindazole |
| SMILES | CSN1CCN(Cc2ccccc2)C(c2cc3cnn(-c4ccc(F)cc4)c3cc2C)C1 |
| InChI | InChI=1S/C26H27FN4S/c1-19-14-25-21(16-28-31(25)23-10-8-22(27)9-11-23)15-24(19)26-18-30(32-2)13-12-29(26)17-20-6-4-3-5-7-20/h3-11,14-16,26H,12-13,17-18H2,1-2H3 |
| InChIKey | HRJPTUZQNMORET-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|