C25H28FN5S — CID 166916695
1-(4-fluorophenyl)-6-methyl-5-[1-(1-propylpyrazol-4-yl)sulfanylpiperidin-4-yl]indazole (PubChem CID 166916695) has the molecular formula C25H28FN5S and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-6-methyl-5-[1-(1-propylpyrazol-4-yl)sulfanylpiperidin-4-yl]indazole.
| Compound Name | 1-(4-fluorophenyl)-6-methyl-5-[1-(1-propylpyrazol-4-yl)sulfanylpiperidin-4-yl]indazole |
|---|---|
| PubChem CID | 166916695 |
| Molecular Formula | C25H28FN5S |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 1-(4-fluorophenyl)-6-methyl-5-[1-(1-propylpyrazol-4-yl)sulfanylpiperidin-4-yl]indazole |
| SMILES | CCCn1cc(SN2CCC(c3cc4cnn(-c5ccc(F)cc5)c4cc3C)CC2)cn1 |
| InChI | InChI=1S/C25H28FN5S/c1-3-10-29-17-23(16-27-29)32-30-11-8-19(9-12-30)24-14-20-15-28-31(25(20)13-18(24)2)22-6-4-21(26)5-7-22/h4-7,13-17,19H,3,8-12H2,1-2H3 |
| InChIKey | HGYRMQUDIXUMTB-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|