C16H20N4O4 — CID 86924991
1-[(4-carbamoyl-2-nitrophenyl)methyl]-N-cyclopropylpyrrolidine-2-carboxamide (PubChem CID 86924991) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-[(4-carbamoyl-2-nitrophenyl)methyl]-N-cyclopropylpyrrolidine-2-carboxamide.
| Compound Name | 1-[(4-carbamoyl-2-nitrophenyl)methyl]-N-cyclopropylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 86924991 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-[(4-carbamoyl-2-nitrophenyl)methyl]-N-cyclopropylpyrrolidine-2-carboxamide |
| SMILES | NC(=O)c1ccc(CN2CCCC2C(=O)NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H20N4O4/c17-15(21)10-3-4-11(14(8-10)20(23)24)9-19-7-1-2-13(19)16(22)18-12-5-6-12/h3-4,8,12-13H,1-2,5-7,9H2,(H2,17,21)(H,18,22) |
| InChIKey | ORXQYWNGUHSYCR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|