C18H22N4O4 — CID 86925215
3-(carbamoylamino)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-(2-methylphenyl)propanamide (PubChem CID 86925215) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-(2-methylphenyl)propanamide.
| Compound Name | 3-(carbamoylamino)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 86925215 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 3-(carbamoylamino)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-(2-methylphenyl)propanamide |
| SMILES | Cc1ccccc1C(CC(=O)NCC(=O)NCc1ccco1)NC(N)=O |
| InChI | InChI=1S/C18H22N4O4/c1-12-5-2-3-7-14(12)15(22-18(19)25)9-16(23)21-11-17(24)20-10-13-6-4-8-26-13/h2-8,15H,9-11H2,1H3,(H,20,24)(H,21,23)(H3,19,22,25) |
| InChIKey | PBICZOQUXPYWNV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |