C24H23N3O3 — CID 56547355
3-(carbamoylamino)-3-(2-methylphenyl)-N-(9H-xanthen-9-yl)propanamide (PubChem CID 56547355) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-(carbamoylamino)-3-(2-methylphenyl)-N-(9H-xanthen-9-yl)propanamide.
| Compound Name | 3-(carbamoylamino)-3-(2-methylphenyl)-N-(9H-xanthen-9-yl)propanamide |
|---|---|
| PubChem CID | 56547355 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-(carbamoylamino)-3-(2-methylphenyl)-N-(9H-xanthen-9-yl)propanamide |
| SMILES | Cc1ccccc1C(CC(=O)NC1c2ccccc2Oc2ccccc21)NC(N)=O |
| InChI | InChI=1S/C24H23N3O3/c1-15-8-2-3-9-16(15)19(26-24(25)29)14-22(28)27-23-17-10-4-6-12-20(17)30-21-13-7-5-11-18(21)23/h2-13,19,23H,14H2,1H3,(H,27,28)(H3,25,26,29) |
| InChIKey | UFMCSGLLDXFUMX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |